Бродифакум

Особенности препарата: использование антикоагулянтов второго поколения, благодаря которым значительно снижен вред нецелевым организмам.

Спецификации
Параметр Значения
Химический состав (IUPAC) 3-[3-[4-(4-bromophenyl)phenyl]-1,2,3,4- tetrahydronaphthalen-1-yl]-4-hydroxychromen-2-one
Рыночные названия Bromfenacoum; Klerat; Talon; Volid
Торговая марка DPC
Идентификатор CAS 56073-10-0
Идентификатор EINECS 259-980-5
Молекулярная формула C31H23BrO3
Молекулярная масса 523.41652 г/моль
Идентификатор InChI InChI=1S/C31H23BrO3/c32-24-15-13-20(14-16-24)19-9-11-21 (12-10-19)23-17-22-5-1-2-6-25(22)27(18-23)29-30(33)26-7 -3-4-8-28(26)35-31(29)34/h1-16,23,27,33H,17-18H2
Хеш-ключ InChI VEUZZDOCACZPRY-UHFFFAOYSA-N
Степень чистоты ≥ 97.0%
Результаты анализа
Параметр Показатель Значение
Внешний вид цвет белый
Активный ингредиент ≥ 97% 97.30%
Уровень pH 4.0 - 9.0 7.2
Величина усушки ≤ 1.0% 0.55%
Способы доставки
Варианты фасовки продукции
Масса Упаковка Транспортировка
≤ 10 кг фольгированный пакет курьер
от 10 до 25 кг пластиковое ведро курьер / службы доставки
≥ 25 кг пластиковое ведро служба доставки
Печать
Обратная связь